Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
3-[(2S)-1-methylpyrrolidin-2-yl]pyridine; sulfuric acid

Inventory

EC number:
200-606-7
EC name:
Nicotine sulphate
CAS number:
65-30-5
CAS number:
65-30-5

Synonyms

Molecular and structural information

Molecular formula:
C10H14N2.1/2H2O4S
Molecular weight:
422.54
SMILES notation:
CN1CCCC1C2=CN=CC=C2.CN1CCCC1C2=CN=CC=C2.OS(=O)(=O)O
InChl:
1S/2C10H14N2.H2O4S/c2*1-12-7-3-5-10(12)9-4-2-6-11-8-9;1-5(2,3)4/h2*2,4,6,8,10H,3,5,7H2,1H3;(H2,1,2,3,4)/t2*10-;/m00./s1
Structural formula:
Chemical structure

Related substances