Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
8-[(4-amino-3-nitrophenyl)diazenyl]-7-hydroxy-N,N,N-trimethylnaphthalen-2-aminium chloride

Inventory

EC number:
269-944-0
EC name:
[8-[(4-amino-3-nitrophenyl)azo]-7-hydroxy-2-naphthyl]trimethylammonium chloride
CAS number:
68391-32-2
CAS number:
68391-32-2

Synonyms

Molecular and structural information

Molecular formula:
ClN5O3
Molecular weight:
401.852
SMILES notation:
[Cl-].C[N+](C)(C)c1ccc2C=CC(=O)C(=N/Nc3ccc(N)c(c3)[N+]([O-])=O)\c2c1
Structural formula:
Chemical structure

Related substances