Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
sodium 3-sulfobenzoate

Inventory

EC number:
241-602-5
EC name:
Sodium hydrogen m-sulphonatobenzoate
CAS number:
17625-03-5
CAS number:
17625-03-5
Synonyms
Names:
Benzoic acid, 3-sulfo-, monosodium salt
Identifier:
IUPAC name
sodium hydrogen 3-sulfonatobenzoate
Identifier:
common name
3-Sulfobenzoic acid monosodium salt
sodium 3-sulfobenzoate

Molecular and structural information

Molecular formula:
C7H6O5S.Na
Molecular weight:
224.16
SMILES notation:
[Na+].[O-]C(=O)c1cccc(c1)S(=O)(=O)[O-]
InChl:
InChI=1/C7H6O5S.Na/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;/h1-4H,(H,8,9)(H,10,11,12);/q;+1/p-2
Structural formula:
Chemical structure

Related substances