Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
amino(imino)methanaminium chloride

Inventory

EC number:
200-002-3
EC name:
Guanidinium chloride
CAS number:
50-01-1
CAS number:
50-01-1
Synonyms
Names:
Guanidine, monohydrochloride
Identifier:
EC name
Guanidinium chloride
Identifier:
IUPAC name
Guanidinium chloride
Identifier:
IUPAC name
guanidine hydrochloride
Identifier:
other: SMILES notation
C(=N)(N)N.Cl
Identifier:
other: InChl
InChI=1S/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H
amino(imino)methanaminium chloride

Molecular and structural information

Molecular formula:
CH5N3.ClH
Molecular weight:
95.531
SMILES notation:
[Cl-].NC(=N)[NH3+]
InChl:
InChI=1/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H
Structural formula:
Chemical structure

Related substances