Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
tetrachloro-μ-hydroxy(μ-methacrylato-O:O')dichromium

Inventory

EC number:
239-147-2
EC name:
Tetrachloro-μ-hydroxy(μ-methacrylato-O:O')dichromium
CAS number:
15096-41-0
CAS number:
15096-41-0
Synonyms
Names:
Identifier:
IUPAC name
Tetrachloro-μ-hydroxy(μ-methacrylato-O:O')dichromium
Identifier:
other: Molecular formula
C4H6Cl4Cr2O3
complexation reaction product of Tetrachloro-μ-hydroxy(μ-methacrylato-O:O')dichromium, isopropylalcohol and water

Molecular and structural information

Molecular formula:
C10H23Cl4Cr2O5
Molecular weight:
469.091
SMILES notation:
Cl[Cr]1(Cl)(O[Cr](Cl)(Cl)(O=C(O1)C(=C)C)(C(C)C)O)(O)C(C)C
InChl:
InChI=1/C4H6O2.2C3H7.4ClH.2Cr.2H2O.O/c1-3(2)4(5)6;2*1-3-2;;;;;;;;;/h1H2,2H3,(H,5,6);2*3H,1-2H3;4*1H;;;2*1H2;/q;;;;;;;+2;+3;;;/p-5
Structural formula:
Chemical structure

Related substances

Identifier:
CAS number
Identity:
15096-41-0