Registration Dossier

Reference substances

Reference substances

IUPAC name:
1,4-bis(chloromethyl)benzene

Inventory

EC number:
210-782-7
EC name:
α,α'-dichloro-p-xylene
CAS number:
623-25-6
CAS number:
623-25-6
Synonyms
Names:
α,α'-dichloro-p-xylene

Molecular and structural information

Molecular formula:
C8H8Cl2
Molecular weight:
175.053
SMILES notation:
C1(CCl)=CC=C(C=C1)CCl
InChl:
InChI=1S/C8H8Cl2/c9-5-7-1-2-8(6-10)4-3-7/h1-4H,5-6H2
Structural formula:
Chemical structure

Related substances