Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-(4-chlorobenzoyl)benzoic acid

Inventory

EC number:
201-615-9
EC name:
2-(4-chlorobenzoyl)benzoic acid
CAS number:
85-56-3
CAS number:
85-56-3
Synonyms
Names:
2-(4-chlorobenzoyl)benzoic acid

Molecular and structural information

Molecular formula:
C14H9ClO3
Molecular weight:
260.673
SMILES notation:
C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)C(=O)O
InChl:
YWECCEXWKFHHQJ-UHFFFAOYSA-N
Structural formula:
Chemical structure

Related substances