Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-hexylresorcinol

Inventory

EC number:
205-257-4
EC name:
4-hexylresorcinol
CAS number:
136-77-6
CAS number:
136-77-6
Synonyms
Names:
1,3-Benzenediol, 4-hexyl-
4-hexylbenzene-1,3-diol

Molecular and structural information

Molecular formula:
C12H18O2
Molecular weight:
194.27
SMILES notation:
CCCCCCc1ccc(O)cc1O
InChl:
InChI=1/C12H18O2/c1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h7-9,13-14H,2-6H2,1H3
Structural formula:
Chemical structure

Related substances