Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,6-diisopropylnaphthalene

Inventory

EC number:
256-971-8
EC name:
1,6-bis(isopropyl)naphthalene
CAS number:
51113-41-8
CAS number:
51113-41-8
Synonyms
Names:
1,6-bis(isopropyl)naphthalene

Molecular and structural information

Molecular formula:
C16H20
Molecular weight:
212.33
SMILES notation:
CC(C)c1ccc2c(cccc2c1)C(C)C
InChl:
InChI=1/C16H20/c1-11(2)13-8-9-16-14(10-13)6-5-7-15(16)12(3)4/h5-12H,1-4H3
Structural formula:
Chemical structure

Related substances