Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,3-didehydro-3-O-sodio-D-erythro-hexono-1,4-lactone

Inventory

EC number:
228-973-9
EC name:
2,3-didehydro-3-O-sodio-D-erythro-hexono-1,4-lactone
CAS number:
6381-77-7
CAS number:
6381-77-7
Synonyms
Names:
Identifier:
IUPAC name
sodium 2-(3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl)-2-hydroxyethanolate (non-preferred name)
2,3-didehydro-3-O-sodio-D-erythro-hexono-1,4-lactone

Molecular and structural information

Molecular formula:
C6H8O6.Na
Molecular weight:
199.12
SMILES notation:
OCC(O)C1OC(=O)C(=C1O)[O-].[Na+]
Structural formula:
Chemical structure

Related substances