Registration Dossier

Diss Factsheets

IUPAC name:
4‘-Ethoxy-3,2‘,3‘-trifluoro-4-pentyloxy-biphenyl-2-ol

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C19H21F3O3
Molecular weight:
354
SMILES notation:
CCCCCOC1=C(F)C(O)=C(C=C1)C1=C(F)C(F)=C(OCC)C=C1
InChl:
InChI=1S/C19H21F3O3/c1-3-5-6-11-25-15-10-8-13(19(23)18(15)22)12-7-9-14(24-4-2)17(21)16(12)20/h7-10,23H,3-6,11H2,1-2H3
Structural formula:
Chemical structure

Related substances