Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-({4-[(2-cyanoethyl)(ethyl)amino]phenyl}diazenyl)-5-nitrobenzonitrile

Inventory

EC number:
240-923-8
EC name:
2-[[4-[(2-cyanoethyl)ethylamino]phenyl]azo]-5-nitrobenzonitrile
CAS number:
16889-10-4
CAS number:
16889-10-4

Synonyms

Molecular and structural information

Molecular formula:
C18H16N6O2
Molecular weight:
348.364
SMILES notation:
N#Cc1c(\N=N\c2ccc(N(CCC#N)CC)cc2)ccc([N+](=O)[O-])c1
InChl:
1S/C18H16N6O2/c1-2-23(11-3-10-19)16-6-4-15(5-7-16)21-22-18-9-8-17(24(25)26)12-14(18)13-20/h4-9,12H,2-3,11H2,1H3/b22-21+
Structural formula:
Chemical structure

Related substances