Registration Dossier

Reference substances

Reference substances

IUPAC name:
1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium chloride

Inventory

EC number:
229-213-9
EC name:
1-(3,4-dimethoxybenzyl)-1,2,3,4-tetrahydro-6,7-dimethoxyisoquinolinium chloride
CAS number:
6429-04-5
CAS number:
6429-04-5
Synonyms
Names:
1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolinium chloride

Molecular and structural information

Molecular formula:
C20H25NO4.ClH
Molecular weight:
379.878
SMILES notation:
[Cl-].COc1ccc(CC2[NH2+]CCc3cc(OC)c(OC)cc23)cc1OC
InChl:
InChI=1/C20H25NO4.ClH/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16;/h5-6,10-12,16,21H,7-9H2,1-4H3;1H
Structural formula:
Chemical structure

Related substances