Registration Dossier

Diss Factsheets

IUPAC name:
1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane

Inventory

CAS number:
995-83-5

Synonyms

Molecular and structural information

Molecular formula:
Si5O4C10H32
Molecular weight:
ca. 356.8
SMILES notation:
C[SiH](C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[SiH](C)(C)
Structural formula:
Chemical structure

Related substances

Categories Display