Registration Dossier

Diss Factsheets

IUPAC name:
Sodium (4-nitrophenyl)methanesulfonate

Inventory

CAS number:
36639-50-6

Synonyms

Molecular and structural information

Molecular formula:
C7H6NNaO5S
Molecular weight:
ca. 239.2
SMILES notation:
O=[N+]([O-])c1ccc(CS(=O)(=O)O[Na])cc1
InChl:
InChI=1/C7H7NO5S.Na/c9-8(10)7-3-1-6(2-4-7)5-14(11,12)13;/h1-4H,5H2,(H,11,12,13);/q;+1/p-1
Structural formula:
Chemical structure

Related substances