Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
butyric acid

Inventory

EC number:
203-532-3
EC name:
Butyric acid
CAS number:
107-92-6
CAS number:
107-92-6
Synonyms
Names:
Butanoic acid

Molecular and structural information

Molecular formula:
C4H8O2
Molecular weight:
88.105
SMILES notation:
CCCC(=O)O
InChl:
InChI=1/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)
Structural formula:
Chemical structure

Related substances