Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
(2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid

Inventory

EC number:
279-393-8
EC name:
(2S-trans)-3-amino-2-methyl-4-oxoazetidine-1-sulphonic acid
CAS number:
80082-65-1
CAS number:
80082-65-1
Synonyms
Names:
Identifier:
IUPAC name
(2S-trans)-3-amino-2-methyl-4-oxoazetidine-1-sulphonic acid
Identifier:
IUPAC name
3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid
(2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid

Molecular and structural information

Molecular formula:
C4H8N2O4S
Molecular weight:
ca. 180.18
SMILES notation:
C[C@H]1[C@H](N)C(=O)N1S(=O)(=O)O
InChl:
1/C4H8N2O4S/c1-2-3(5)4(7)6(2)11(8,9)10/h2-3H,5H2,1H3,(H,8,9,10)/t2-,3-/m0/s1
Structural formula:
Chemical structure

Related substances