Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
5-(dimethylamino)-2-nitrobenzoic acid

Inventory

CAS number:
62876-66-8
Synonyms
Names:
5-(dimethylamino)-2-nitrobenzoic acid

Molecular and structural information

Molecular formula:
C9H10N2O4
Molecular weight:
210.19
SMILES notation:
CN(C)c1cc(c(cc1)[N+]([O-])=O)C(=O)O
InChl:
InChI=1S/C9H10N2O4/c1-10(2)6-3-4-8(11(14)15)7(5-6)9(12)13/h3-5H,1-2H3,(H,12,13)
Structural formula:
Chemical structure

Related substances