Registration Dossier

IUPAC name:
1-butyl-2,3-dicyclohexyl-1-methylguanidine

Inventory

CAS number:
1192718-95-8

Synonyms

Molecular and structural information

Molecular formula:
C18H35N3
Molecular weight:
ca. 293.491
SMILES notation:
CCCCN(C)C(\NC1CCCCC1)=N\C2CCCCC2
Structural formula:
Chemical structure

Related substances