Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(+-)-Methyl trans-3-oxo-2-pentyl-1-cyclopentaneacetate


CAS number:
common name
Trans Hedione

Molecular and structural information

Molecular formula:
C13 H22 O3
Molecular weight:
SMILES notation:
InChI=1/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-11H,3-9H2,1-2H3/t10-,11-/m0/s1/i1-12,2-12,3-12,4-12,5-12,6-12,7-12,8-12,9-12,10-12,11-12,12-12,13-12,14-16,15-16,16-16Structural formula:
Structural formula:
Chemical structure

Related substances