Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
trisodium hydrogen 2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetate

Inventory

EC number:
205-758-8
EC name:
Trisodium hydrogen ethylenediaminetetraacetate
CAS number:
150-38-9
CAS number:
150-38-9

Synonyms

Molecular and structural information

Molecular formula:
C10H16N2O8.3Na
Molecular weight:
360.204
SMILES notation:
[H+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O
InChl:
InChI=1/C10H16N2O8.3Na.H2/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;1H/q;4*+1/p-4
Structural formula:
Chemical structure

Related substances