Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
sodium 2-(2,4-dichlorophenoxy)acetate

Inventory

EC number:
220-290-4
EC name:
Sodium 2,4-dichlorophenoxyacetate
CAS number:
2702-72-9
CAS number:
2702-72-9
Synonyms
Names:
2,4-D sodium salt
Acetic acid, (2,4-dichlorophenoxy)-, sodium salt
sodium (2,4-dichlorophenoxy)acetate

Molecular and structural information

Molecular formula:
C8H6Cl2O3.Na
Molecular weight:
243.019
SMILES notation:
[Na+].[O-]C(=O)COc1ccc(Cl)cc1Cl
InChl:
InChI=1/C8H6Cl2O3.Na/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1
Structural formula:
Chemical structure

Related substances