Registration Dossier

General information

Inventory

EC number:
253-951-0
EC name:
Undec-10-enoyl chloride
CAS number:
38460-95-6

No inventory information available

Reference substance information

IUPAC name:
undec-10-enoyl chloride
Synonyms
Names:
10-undecenoyl chloride
undecenoyl chloride
Identifier:
CAS number
38460-95-6
undec-10-enoyl chloride

CAS information

CAS number:
38460-95-6

Molecular and structural information

Molecular formula:
C11H19ClO
Molecular weight:
202.72
SMILES notation:
ClC(=O)CCCCCCCCC=C
InChl:
InChI=1/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2
Structural formula:
Chemical structure