Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
4-methoxy-4-oxobut-2-enoic acid

Inventory

EC number:
221-271-3
EC name:
Methyl hydrogen maleate
CAS number:
3052-50-4
CAS number:
3052-50-4
Synonyms
Names:
2-Butenedioic acid (2Z)-, monomethyl ester
2-Butenedioic acid (Z)-, monomethyl ester

Molecular and structural information

Molecular formula:
C5H6O4
Molecular weight:
130.099
SMILES notation:
COC(=O)\C=C/C(=O)O
InChl:
InChI=1/C5H6O4/c1-9-5(8)3-2-4(6)7/h2-3H,1H3,(H,6,7)
Structural formula:
Chemical structure

Related substances