Registration Dossier

General information

Inventory

EC number:
203-994-6
EC name:
Myristoyl chloride
CAS number:
112-64-1

No inventory information available

Reference substance information

IUPAC name:
tetradecanoyl chloride
Synonyms
Names:
Myristoyl chloride
Tetradecanoyl chloride
Identifier:
IUPAC name
tetradecanoyl chloride
Identifier:
other: SMILES notation
CCCCCCCCCCCCCC(=O)Cl
Identifier:
other: InChl
InChI=1/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3
Tetradecanoyl chloride

CAS information

CAS number:
112-64-1

Molecular and structural information

Molecular formula:
C14H27ClO
Molecular weight:
246.819
SMILES notation:
O=C(CCCCCCCCCCCCC)Cl
InChl:
1S/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3
Structural formula:
Chemical structure