Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-aminonaphthalene-1,5-disulfonic acid

Inventory

EC number:
204-201-6
EC name:
2-aminonaphthalene-1,5-disulphonic acid
CAS number:
117-62-4
CAS number:
117-62-4

Synonyms

Molecular and structural information

Molecular formula:
C10H9NO6S2
Molecular weight:
303.314
SMILES notation:
c12c(c(ccc2)S(O)(=O)=O)ccc(c1S(O)(=O)=O)N
InChl:
1S/C10H9NO6S2/c11-8-5-4-6-7(10(8)19(15,16)17)2-1-3-9(6)18(12,13)14/h1-5H,11H2,(H,12,13,14)(H,15,16,17)
Structural formula:
Chemical structure

Related substances