Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
[(1E)-3,3-diethoxyprop-1-en-1-yl]benzene

Inventory

EC number:
230-467-8
EC name:
(3,3-diethoxy-1-propenyl)benzene
CAS number:
7148-78-9
CAS number:
7148-78-9
Synonyms
Names:
Cinnamaldehyde, diethyl acetal
(3,3-diethoxy-1-propenyl)benzene

Molecular and structural information

Molecular formula:
C13H18O2
Molecular weight:
ca. 206.28
SMILES notation:
O(C(OCC)/C=C/c1ccccc1)CC
InChl:
InChI=1S/C13H18O2/c1-3-14-13(15-4-2)11-10-12-8-6-5-7-9-12/h5-11,13H,3-4H2,1-2H3/b11-10+
Structural formula:
Chemical structure

Related substances

Categories Display