Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
ammonium myristate

Inventory

EC number:
240-599-8
EC name:
Ammonium myristate
CAS number:
16530-71-5
CAS number:
16530-71-5
Synonyms
Names:
ammonium myristate

Molecular and structural information

Molecular formula:
C14H28O2.H3N
Molecular weight:
245.401
SMILES notation:
[NH4+].CCCCCCCCCCCCCC(=O)[O-]
InChl:
InChI=1/C14H28O2.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;/h2-13H2,1H3,(H,15,16);1H3
Structural formula:
Chemical structure

Related substances