Registration Dossier

Diss Factsheets

IUPAC name:
2'-Bromo-2-phenyl-9,9'-spirobi[fluorene]

Inventory

CAS number:
1911626-20-4

Synonyms

Molecular and structural information

Molecular formula:
C31H19Br
Molecular weight:
471.39
SMILES notation:
BrC1=CC=C2C3=CC=CC=C3C3(C4=CC=CC=C4C4=CC=C(C=C34)C3=CC=CC=C3)C2=C1
InChl:
InChI=1/C31H19Br/c32-22-15-17-26-24-11-5-7-13-28(24)31(30(26)19-22)27-12-6-4-10-23(27)25-16-14-21(18-29(25)31)20-8-2-1-3-9-20/h1-19H
Structural formula:
Chemical structure

Related substances

Categories Display