Registration Dossier

Diss Factsheets

IUPAC name:
1-Propen-1,2,3-tricarbonsäure tris(2-(2,2,3,3,3,4,4,4-heptafluorbutoxy)-1-(methyl)-ethyl)ester

Inventory

CAS number:
1449567-31-0

Synonyms

Molecular and structural information

Molecular formula:
C27H27F21O9
Molecular weight:
894
SMILES notation:
CC(COCC(F)(F)C(F)(F)C(F)(F)F)OC(=O)CC(=CC(=O)OC(C)COCC(F)(F)C(F)(F)C(F)(F)F)C(=O)OC(C)COCC(F)(F)C(F)(F)C(F)(F)F
Structural formula:
Chemical structure

Related substances