Registration Dossier

Diss Factsheets

IUPAC name:
1-[2-(Amino)-1-(4-hydroxyphenyl)ehtyl]cyclohexanol

Inventory

CAS number:
149289-29-2

Synonyms

Molecular and structural information

Molecular formula:
C14H21NO2
Molecular weight:
ca. 235.33
SMILES notation:
C1CCC(CC1)(C(CN)C2=CC=C(C=C2)O)O
InChl:
1S/C14H21NO2/c15-10-13(11-4-6-12(16)7-5-11)14(17)8-2-1-3-9-14/h4-7,13,16-17H,1-3,8-10,15H2
Structural formula:
Chemical structure

Related substances