Registration Dossier

Diss Factsheets

IUPAC name:
tert-Butyl [(1R,2S,5S)-2-[[2-[(5-chloropyridin-2-yl)amino]-2-oxoacetyl]amino]-5-(dimethylaminocarbonyl)cyclohexyl]carbamate

Inventory

CAS number:
480452-36-6

Synonyms

Molecular and structural information

Molecular formula:
C21H30ClN5O5
Molecular weight:
ca. 467.95
SMILES notation:
O=C(Nc1ccc(Cl)cn1)C(=O)N[C@H]2CC[C@@H](C[C@H]2NC(=O)OC(C)(C)C)C(=O)N(C)C
Structural formula:
Chemical structure

Related substances