Registration Dossier

Diss Factsheets

IUPAC name:
2-methylbenzene-1,4-diyl bis{4-[3-(acryloyloxy)propoxy]benzoate}

Inventory

EC number:
425-560-7
EC name:
-
CAS number:
-
Description:
RM257
CAS number:
174063-87-7

Synonyms

Molecular and structural information

Molecular formula:
C33H32O10
Molecular weight:
588
SMILES notation:
C3=CC(OCCCOC(=O)C=C)=CC=C3C(=O)OC1=C(C)C=C(OC(=O)C2=CC=C(OCCCOC(=O)C=C)C=C2)C=C1
Structural formula:
Chemical structure

Related substances