Registration Dossier

IUPAC name:
4-(2-methylpropyl)benzyl propyl ether

Inventory

CAS number:
1631962-93-0

Synonyms

Molecular and structural information

Molecular formula:
C14H22O
Molecular weight:
ca. 206.17
SMILES notation:
CC(C)Cc1ccc(COCCC)cc1
InChl:
InChI=1S/C14H22O/c1-4-9-15-11-14-7-5-13(6-8-14)10-12(2)3/h5-8,12H,4,9-11H2,1-3H3
Structural formula:
Chemical structure

Related substances