Registration Dossier

Reference substances

Reference substances

IUPAC name:
2-iodobenzoic acid

Inventory

EC number:
201-850-7
EC name:
2-iodobenzoic acid
CAS number:
88-67-5
CAS number:
88-67-5
Synonyms
Names:
Benzoic acid, 2-iodo-
2-iodobenzoic acid

Molecular and structural information

Molecular formula:
C7H5IO2
Molecular weight:
248.018
SMILES notation:
OC(=O)c1ccccc1I
InChl:
InChI=1/C7H5IO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10)
Structural formula:
Chemical structure

Related substances