Registration Dossier

Reference substances

Reference substances

IUPAC name:
heptanedioic acid

Inventory

EC number:
203-840-8
EC name:
Pimelic acid
CAS number:
111-16-0
CAS number:
111-16-0
Synonyms
Names:
Heptanedioic acid
pimelic acid

Molecular and structural information

Molecular formula:
C7H12O4
Molecular weight:
160.168
SMILES notation:
OC(=O)CCCCCC(=O)O
InChl:
InChI=1/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11)
Structural formula:
Chemical structure

Related substances