Registration Dossier

Reference substances

Reference substances

IUPAC name:
2,4,6-trinitrophenol

Inventory

EC number:
201-865-9
EC name:
Picric acid
CAS number:
88-89-1
CAS number:
88-89-1
Synonyms
Names:
2,4,6-trinitrophenol

Molecular and structural information

Molecular formula:
C6H3N3O7
Molecular weight:
ca. 229.1
SMILES notation:
C1=C(C=C(C(=C1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-]
Structural formula:
Chemical structure

Related substances