Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
hydrogen potassium 2-octadec-1-en-1-ylsuccinate

Inventory

EC number:
296-086-4
EC name:
Potassium hydrogen 2-octadecenylsuccinate
CAS number:
92218-39-8
CAS number:
92218-39-8

Synonyms

Molecular and structural information

Molecular formula:
C22H40O4.K
Molecular weight:
408.657
SMILES notation:
[H+].[K+].[O-]C(=O)CC(C=CCCCCCCCCCCCCCCCC)C([O-])=O
InChl:
InChI=1/C22H40O4.K.H2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22(25)26)19-21(23)24;;/h17-18,20H,2-16,19H2,1H3,(H,23,24)(H,25,26);;1H/q;2*+1/p-2
Structural formula:
Chemical structure

Related substances