Registration Dossier

Diss Factsheets

IUPAC name:
(S)-2-amino-5-methoxytetralin hydrochloride

Inventory

CAS number:
58349-17-0

Synonyms

Molecular and structural information

Molecular formula:
C11H16ClNO
Molecular weight:
>= 213 - < 214
SMILES notation:
N[C@@H]1CC2=CC=CC(OC)=C2CC1.Cl
InChl:
1S/C11H15NO.ClH/c1-13-11-4-2-3-8-7-9(12)5-6-10(8)11;/h2-4,9H,5-7,12H2,1H3;1H/t9-;/m0./s1
Structural formula:
Chemical structure

Related substances