Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1-(2-ethylbutyl)cyclohexanecarbonyl chloride

Inventory

CAS number:
211515-46-7
Synonyms
Names:
Identifier:
IUPAC name
1-(2-ethylbutyl)cyclohexane-1-carbonyl chloride
1-(2-ethylbutyl)cyclohexanecarbonyl chloride

Molecular and structural information

Molecular formula:
C13 H23 Cl O
Molecular weight:
230.78
SMILES notation:
ClC(=O)C1(CC(CC)CC)CCCCC1
Structural formula:
Chemical structure

Related substances