Registration Dossier

IUPAC name:
(4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide; 4-chlorobenzene-1-sulfonic acid

Inventory

CAS number:
916439-93-5

Synonyms

Molecular and structural information

Molecular formula:
C29H32ClN3O10S
Molecular weight:
ca. 650.096
SMILES notation:
OS(=O)(=O)C1=CC=C(Cl)C=C1.CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=CC(O)=C4C(=O)C3=C(O)[C@]2(O)C(=O)C(C(N)=O)=C1O)N(C)C
Structural formula:
Chemical structure

Related substances