Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1-amino-4-({3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-4-sulfophenyl}amino)-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid

Inventory

EC number:
236-363-9
EC name:
1-amino-4-(2'-(4',6'-dichloro-s-triazin-2-yl)amino)phenylamino)9,10-dihydro-9,10-dioxoanthracene-2,4'-disulphonic acid
CAS number:
13324-20-4
CAS number:
13324-20-4

Synonyms

Molecular and structural information

Molecular formula:
C23H14Cl2N6O8S2
Molecular weight:
637.436
SMILES notation:
c12c(C(c3ccccc3C2=O)=O)c(c(S(O)(=O)=O)cc1Nc1cc(c(S(O)(=O)=O)cc1)Nc1nc(nc(n1)Cl)Cl)N
InChl:
1S/C23H14Cl2N6O8S2/c24-21-29-22(25)31-23(30-21)28-12-7-9(5-6-14(12)40(34,35)36)27-13-8-15(41(37,38)39)18(26)17-16(13)19(32)10-3-1-2-4-11(10)20(17)33/h1-8,27H,26H2,(H,34,35,36)(H,37,38,39)(H,28,29,30,31)
Structural formula:
Chemical structure

Related substances