Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Dipotassium [hexane-1,6-diylbis[nitrilobis(methylene)]]diphosphonate

Inventory

Synonyms
Names:
Identifier:
IUPAC name
Dipotassium [hexane-1,6-diylbis[nitrilobis(methylene)]]diphosphonate
Identifier:
common name
HMDTMP-Diphosphonate-2K

Molecular and structural information

Molecular formula:
C8H20K2N2O6P2
Molecular weight:
ca. 380.4
SMILES notation:
HMDTMP-Diphosphonate-2K (Isomer 1)
[O-]P(=O)(CNCCCCCCNCP(=O)(O)[O-])O.[K+].[K+]

HMDTMP-Diphosphonate-2K (Isomer 2)
NCCCCCCN(CP(=O)(O)[O-])CP(=O)(O)[O-].[K+].[K+]
Structural formula:
Chemical structure

Related substances