Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-(4-methoxyphenyl)-4-oxobutanoic acid

Inventory

EC number:
221-593-4
EC name:
3-(4-methoxybenzoyl)propionic acid
CAS number:
3153-44-4
CAS number:
3153-44-4
Synonyms
Names:
3-(4-methoxybenzoyl)propionic_acid

Molecular and structural information

Molecular formula:
C11H12O4
Molecular weight:
208.211
SMILES notation:
COc1ccc(cc1)C(=O)CCC(=O)O
InChl:
InChI=1/C11H12O4/c1-15-9-4-2-8(3-5-9)10(12)6-7-11(13)14/h2-5H,6-7H2,1H3,(H,13,14)
Structural formula:
Chemical structure

Related substances

Categories Display