Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3-(naphthalen-1-yl)-2-[(oxolan-2-yl)methyl]propanoic acid

Inventory

EC number:
246-926-0
EC name:
Tetrahydro-α-(1-naphthylmethyl)furan-2-propionic acid
CAS number:
25379-26-4
CAS number:
25379-26-4
Synonyms
Names:
2-FURANPROPANOIC ACID, TETRAHYDRO-.ALPHA.-(1-NAPHTHALENYLMETHYL)-
2-[(naphthalene-1-yl)methyl]-3-(tetrahydrofuran-2--yl)propanoic acid
Naftidrofuryl acid
Naphthyl tetrahydrofurfurylpropionic acid
3-(1-naphthyl)-2-(tetrahydrofuran-2-ylmethyl)propanoic acid

Molecular and structural information

Molecular formula:
C18H20O3
Molecular weight:
284.35
SMILES notation:
OC(=O)C(CC1CCCO1)Cc2cccc3ccccc23
InChl:
InChI=1/C18H20O3/c19-18(20)15(12-16-8-4-10-21-16)11-14-7-3-6-13-5-1-2-9-17(13)14/h1-3,5-7,9,15-16H,4,8,10-12H2,(H,19,20)
Structural formula:
Chemical structure

Related substances