Registration Dossier

Diss Factsheets

IUPAC name:
acetone;[3-[2-[benzyl(tert-butyl)amino]acetyl]-5-(dimethylcarbamoyloxy)phenyl] N,N-dimethylcarbamate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C28 H39 N3 O6
Molecular weight:
ca. 513.64
SMILES notation:
CN(C)C(=O)Oc1cc(OC(=O)N(C)C)cc(c1)C(=O)CN(Cc2ccccc2)C(C)(C)C.CC(=O)C
Structural formula:
Chemical structure

Related substances

Categories Display