Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-chlorobenzene-1-sulfonic acid

Inventory

EC number:
202-690-0
EC name:
4-chlorobenzenesulphonic acid
CAS number:
98-66-8
CAS number:
98-66-8
Synonyms
Names:
Benzenesulfonic acid, 4-chloro-
Identifier:
other: SMILES notation
C1=CC(=CC=C1S(=O)(=O)O)Cl
4-chlorobenzenesulfonic acid

Molecular and structural information

Molecular formula:
C6H5ClO3S
Molecular weight:
192.62
SMILES notation:
OS(=O)(=O)c1ccc(Cl)cc1
InChl:
InChI=1/C6H5ClO3S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H,8,9,10)
Structural formula:
Chemical structure

Related substances

Categories Display