Registration Dossier

Diss Factsheets

IUPAC name:
5-phenyl-1-(phenylmethyl)-2,4,6(1H,3H,5H)-pyrimidinetrione

Inventory

EC number:
276-940-2
EC name:
1-benzyl-5-phenylbarbituric acid
CAS number:
72846-00-5
CAS number:
72846-00-5

Synonyms

Molecular and structural information

Molecular formula:
C17H14N2O3
Molecular weight:
294.31
SMILES notation:
O=C(N(C(=O)C(c(cccc1)c1)C2=O)Cc(cccc3)c3)N2
Structural formula:
Chemical structure

Related substances

Categories Display