Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
{4-[(4-methylphenyl)sulfanyl]phenyl}(phenyl)methanone

Inventory

EC number:
281-064-9
EC name:
4-(4-methylphenylthio)benzophenone
CAS number:
83846-85-9
CAS number:
83846-85-9
Synonyms
Names:
Methanone, [4-[(4-methylphenyl)thio]phenyl]phenyl-
Identifier:
IUPAC name
{4-[(4-methylphenyl)sulfanyl]phenyl}(phenyl)methanone
Identifier:
ChemSpider ID
152077
Identifier:
common name
4-(p-Tolylthio) Benzophenone
{4-[(4-methylphenyl)sulfanyl]phenyl}(phenyl)methanone

Molecular and structural information

Molecular formula:
C20H16OS
Molecular weight:
304.405
SMILES notation:
Cc1ccc(Sc2ccc(cc2)C(=O)c3ccccc3)cc1
InChl:
InChI=1/C20H16OS/c1-15-7-11-18(12-8-15)22-19-13-9-17(10-14-19)20(21)16-5-3-2-4-6-16/h2-14H,1H3
Structural formula:
Chemical structure

Related substances

Categories Display