Registration Dossier

Diss Factsheets

IUPAC name:
1-(4-Hydroxyphenyl)heptane-1,3-dione

Inventory

CAS number:
1137261-89-2

Synonyms

Molecular and structural information

Molecular formula:
C15H20O3
Molecular weight:
ca. 248.32
SMILES notation:
OC1=CC=C(CCC(CC(CCCC)=O)=O)C=C1
InChl:
1S/C15H20O3/c1-2-3-4-14(17)11-15(18)10-7-12-5-8-13(16)9-6-12/h5-6,8-9,16H,2-4,7,10-11H2,1H3
Structural formula:
Chemical structure

Related substances